C10H15NO3 — CID 137272905
(2Z)-2-(1,2-dihydroxyethylidene)-3-imino-5,5-dimethylcyclohexan-1-one (PubChem CID 137272905) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (2Z)-2-(1,2-dihydroxyethylidene)-3-imino-5,5-dimethylcyclohexan-1-one.
| Compound Name | (2Z)-2-(1,2-dihydroxyethylidene)-3-imino-5,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 137272905 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (2Z)-2-(1,2-dihydroxyethylidene)-3-imino-5,5-dimethylcyclohexan-1-one |
| SMILES | [H]/N=C1\CC(C)(C)CC(=O)\C1=C(/O)CO |
| InChI | InChI=1S/C10H15NO3/c1-10(2)3-6(11)9(7(13)4-10)8(14)5-12/h11-12,14H,3-5H2,1-2H3/b9-8-,11-6+ |
| InChIKey | RFJQVOGBARZKNH-XSONURMYSA-N |
| XLogP | 1.20 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|