About 2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione
2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 89184950) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione.
Molecular Properties
| Compound Name | 2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione |
| PubChem CID | 89184950 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CCC(C)=C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C12H18O2/c1-5-8(2)11-9(13)6-12(3,4)7-10(11)14/h5-7H2,1-4H3 |
| InChIKey | QDLSGPFEXOYMAA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione?
The IUPAC name of 2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione (CID 89184950) is 2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione.
What is the SMILES notation for 2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione?
The canonical SMILES for 2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione is CCC(C)=C1C(=O)CC(C)(C)CC1=O.
What is the InChIKey of 2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione?
The InChIKey is QDLSGPFEXOYMAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-5-8(2)11-9(13)6-12(3,4)7-10(11)14/h5-7H2,1-4H3.
What are the key properties of 2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione?
2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione has a molecular weight of 194.27 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-ylidene-5,5-dimethylcyclohexane-1,3-dione is sourced from PubChem (CID 89184950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).