C12H23NO — CID 175273412
ethanamine;2,3,5,5-tetramethylcyclohex-2-en-1-one (PubChem CID 175273412) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is ethanamine;2,3,5,5-tetramethylcyclohex-2-en-1-one.
| Compound Name | ethanamine;2,3,5,5-tetramethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 175273412 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | ethanamine;2,3,5,5-tetramethylcyclohex-2-en-1-one |
| SMILES | CC1=C(C)C(=O)CC(C)(C)C1.CCN |
| InChI | InChI=1S/C10H16O.C2H7N/c1-7-5-10(3,4)6-9(11)8(7)2;1-2-3/h5-6H2,1-4H3;2-3H2,1H3 |
| InChIKey | UTFVYQPZHKEDLS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |