C32H33NO4S — CID 136859374
(2R)-2-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]-3-tritylsulfanylpropanoic acid (PubChem CID 136859374) has the molecular formula C32H33NO4S and a molecular weight of 527.69 g/mol. Its IUPAC name is (2R)-2-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]-3-tritylsulfanylpropanoic acid.
| Compound Name | (2R)-2-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]-3-tritylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 136859374 |
| Molecular Formula | C32H33NO4S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | (2R)-2-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]-3-tritylsulfanylpropanoic acid |
| SMILES | C/C(=N\[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O)C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C32H33NO4S/c1-22(29-27(34)19-31(2,3)20-28(29)35)33-26(30(36)37)21-38-32(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,26,34H,19-21H2,1-3H3,(H,36,37)/b33-22+/t26-/m0/s1 |
| InChIKey | VZWSWPQNVIVUTL-KBPINPGLSA-N |
| XLogP | 6.83 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|