C23H29N2O4+ — CID 7304541
[4-(1,3-dioxoisoindol-2-yl)-1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)butylidene]-propan-2-ylazanium (PubChem CID 7304541) has the molecular formula C23H29N2O4+ and a molecular weight of 397.50 g/mol. Its IUPAC name is [4-(1,3-dioxoisoindol-2-yl)-1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)butylidene]-propan-2-ylazanium.
| Compound Name | [4-(1,3-dioxoisoindol-2-yl)-1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)butylidene]-propan-2-ylazanium |
|---|---|
| PubChem CID | 7304541 |
| Molecular Formula | C23H29N2O4+ |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | [4-(1,3-dioxoisoindol-2-yl)-1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)butylidene]-propan-2-ylazanium |
| SMILES | CC(C)/[NH+]=C(\CCCN1C(=O)c2ccccc2C1=O)C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C23H28N2O4/c1-14(2)24-17(20-18(26)12-23(3,4)13-19(20)27)10-7-11-25-21(28)15-8-5-6-9-16(15)22(25)29/h5-6,8-9,14,26H,7,10-13H2,1-4H3/p+1/b24-17+ |
| InChIKey | MSKOEGMEZHYLCU-JJIBRWJFSA-O |
| XLogP | 2.19 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|