C22H23N2O6- — CID 7305589
2-[[2-[4-(1,3-dioxoisoindol-2-yl)butanoyl]-5,5-dimethyl-3-oxocyclohexylidene]amino]acetate (PubChem CID 7305589) has the molecular formula C22H23N2O6- and a molecular weight of 411.43 g/mol. Its IUPAC name is 2-[[2-[4-(1,3-dioxoisoindol-2-yl)butanoyl]-5,5-dimethyl-3-oxocyclohexylidene]amino]acetate.
| Compound Name | 2-[[2-[4-(1,3-dioxoisoindol-2-yl)butanoyl]-5,5-dimethyl-3-oxocyclohexylidene]amino]acetate |
|---|---|
| PubChem CID | 7305589 |
| Molecular Formula | C22H23N2O6- |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-[[2-[4-(1,3-dioxoisoindol-2-yl)butanoyl]-5,5-dimethyl-3-oxocyclohexylidene]amino]acetate |
| SMILES | CC1(C)CC(=O)C(C(=O)CCCN2C(=O)c3ccccc3C2=O)/C(=N/CC(=O)[O-])C1 |
| InChI | InChI=1S/C22H24N2O6/c1-22(2)10-15(23-12-18(27)28)19(17(26)11-22)16(25)8-5-9-24-20(29)13-6-3-4-7-14(13)21(24)30/h3-4,6-7,19H,5,8-12H2,1-2H3,(H,27,28)/p-1/b23-15+ |
| InChIKey | SOPDPFYYKNSNNA-HZHRSRAPSA-M |
| XLogP | 0.83 |
| TPSA | 124.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|