C24H30N2O4 — CID 7305583
2-[4-[2-[(2R)-butan-2-yl]imino-4,4-dimethyl-6-oxocyclohexyl]-4-oxobutyl]isoindole-1,3-dione (PubChem CID 7305583) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[4-[2-[(2R)-butan-2-yl]imino-4,4-dimethyl-6-oxocyclohexyl]-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[2-[(2R)-butan-2-yl]imino-4,4-dimethyl-6-oxocyclohexyl]-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 7305583 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-[4-[2-[(2R)-butan-2-yl]imino-4,4-dimethyl-6-oxocyclohexyl]-4-oxobutyl]isoindole-1,3-dione |
| SMILES | CC[C@@H](C)/N=C1\CC(C)(C)CC(=O)C1C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H30N2O4/c1-5-15(2)25-18-13-24(3,4)14-20(28)21(18)19(27)11-8-12-26-22(29)16-9-6-7-10-17(16)23(26)30/h6-7,9-10,15,21H,5,8,11-14H2,1-4H3/b25-18+/t15-,21?/m1/s1 |
| InChIKey | FVBKOPUAJFKFHF-QWFGPUDXSA-N |
| XLogP | 3.88 |
| TPSA | 83.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|