C19H23NO4 — CID 167549198
2-(6,6-dimethyl-5,7-dioxononyl)isoindole-1,3-dione (PubChem CID 167549198) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(6,6-dimethyl-5,7-dioxononyl)isoindole-1,3-dione.
| Compound Name | 2-(6,6-dimethyl-5,7-dioxononyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167549198 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-(6,6-dimethyl-5,7-dioxononyl)isoindole-1,3-dione |
| SMILES | CCC(=O)C(C)(C)C(=O)CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H23NO4/c1-4-15(21)19(2,3)16(22)11-7-8-12-20-17(23)13-9-5-6-10-14(13)18(20)24/h5-6,9-10H,4,7-8,11-12H2,1-3H3 |
| InChIKey | CEOZIADRADDFAT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|