C11H17NO3 — CID 135410672
2-(ethoxyiminomethyl)-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 135410672) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-(ethoxyiminomethyl)-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 2-(ethoxyiminomethyl)-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135410672 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-(ethoxyiminomethyl)-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | CCON=CC1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C11H17NO3/c1-4-15-12-7-8-9(13)5-11(2,3)6-10(8)14/h7,13H,4-6H2,1-3H3 |
| InChIKey | MSAXLRZRICUGMK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|