C15H20BrNO2 — CID 137203918
2-[[(2E,4Z)-6-bromohexa-2,4-dien-3-yl]iminomethyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 137203918) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is 2-[[(2E,4Z)-6-bromohexa-2,4-dien-3-yl]iminomethyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 2-[[(2E,4Z)-6-bromohexa-2,4-dien-3-yl]iminomethyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 137203918 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-[[(2E,4Z)-6-bromohexa-2,4-dien-3-yl]iminomethyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | C/C=C(\C=C/CBr)/N=C/C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C15H20BrNO2/c1-4-11(6-5-7-16)17-10-12-13(18)8-15(2,3)9-14(12)19/h4-6,10,18H,7-9H2,1-3H3/b6-5-,11-4+,17-10+ |
| InChIKey | HSNGLUHEZHIFHA-PVQSWZCHSA-N |
| XLogP | 4.11 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|