C19H26N2O2 — CID 136579270
3-hydroxy-5,5-dimethyl-2-[3-(N-methylanilino)propyliminomethyl]cyclohex-2-en-1-one (PubChem CID 136579270) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-hydroxy-5,5-dimethyl-2-[3-(N-methylanilino)propyliminomethyl]cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5,5-dimethyl-2-[3-(N-methylanilino)propyliminomethyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 136579270 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 3-hydroxy-5,5-dimethyl-2-[3-(N-methylanilino)propyliminomethyl]cyclohex-2-en-1-one |
| SMILES | CN(CCC/N=C/C1=C(O)CC(C)(C)CC1=O)c1ccccc1 |
| InChI | InChI=1S/C19H26N2O2/c1-19(2)12-17(22)16(18(23)13-19)14-20-10-7-11-21(3)15-8-5-4-6-9-15/h4-6,8-9,14,22H,7,10-13H2,1-3H3/b20-14+ |
| InChIKey | MDUQVSATVPMBMI-XSFVSMFZSA-N |
| XLogP | 3.78 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|