C13H8N2O2S — CID 135476333
3-hydroxy-2-(1,3-thiazol-2-yliminomethyl)inden-1-one (PubChem CID 135476333) has the molecular formula C13H8N2O2S and a molecular weight of 256.29 g/mol. Its IUPAC name is 3-hydroxy-2-(1,3-thiazol-2-yliminomethyl)inden-1-one.
| Compound Name | 3-hydroxy-2-(1,3-thiazol-2-yliminomethyl)inden-1-one |
|---|---|
| PubChem CID | 135476333 |
| Molecular Formula | C13H8N2O2S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 3-hydroxy-2-(1,3-thiazol-2-yliminomethyl)inden-1-one |
| SMILES | O=C1C(C=Nc2nccs2)=C(O)c2ccccc21 |
| InChI | InChI=1S/C13H8N2O2S/c16-11-8-3-1-2-4-9(8)12(17)10(11)7-15-13-14-5-6-18-13/h1-7,16H |
| InChIKey | JUSXWIIUUZHKIN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|