C11H9N3O2S — CID 42336554
2-[(Z)-(1,3-thiazol-2-ylhydrazinylidene)methyl]benzoic acid (PubChem CID 42336554) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-[(Z)-(1,3-thiazol-2-ylhydrazinylidene)methyl]benzoic acid.
| Compound Name | 2-[(Z)-(1,3-thiazol-2-ylhydrazinylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 42336554 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2-[(Z)-(1,3-thiazol-2-ylhydrazinylidene)methyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1/C=N\Nc1nccs1 |
| InChI | InChI=1S/C11H9N3O2S/c15-10(16)9-4-2-1-3-8(9)7-13-14-11-12-5-6-17-11/h1-7H,(H,12,14)(H,15,16)/b13-7- |
| InChIKey | AJVSZNKYSOBGGS-QPEQYQDCSA-N |
| XLogP | 2.29 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|