C17H13FN4O2S — CID 168626774
4-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]-2-fluorobenzoic acid (PubChem CID 168626774) has the molecular formula C17H13FN4O2S and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]-2-fluorobenzoic acid.
| Compound Name | 4-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 168626774 |
| Molecular Formula | C17H13FN4O2S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 4-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]-2-fluorobenzoic acid |
| SMILES | Nc1csc(NN=Cc2ccccc2-c2ccc(C(=O)O)c(F)c2)n1 |
| InChI | InChI=1S/C17H13FN4O2S/c18-14-7-10(5-6-13(14)16(23)24)12-4-2-1-3-11(12)8-20-22-17-21-15(19)9-25-17/h1-9H,19H2,(H,21,22)(H,23,24) |
| InChIKey | XBIVFGQKKXYRNV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|