C21H18ClN3O4S — CID 168623825
2-chloro-4-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl]benzoic acid (PubChem CID 168623825) has the molecular formula C21H18ClN3O4S and a molecular weight of 443.91 g/mol. Its IUPAC name is 2-chloro-4-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl]benzoic acid.
| Compound Name | 2-chloro-4-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 168623825 |
| Molecular Formula | C21H18ClN3O4S |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 2-chloro-4-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl]benzoic acid |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccccc2-c2ccc(C(=O)O)c(Cl)c2)n1 |
| InChI | InChI=1S/C21H18ClN3O4S/c1-2-29-19(26)10-15-12-30-21(24-15)25-23-11-14-5-3-4-6-16(14)13-7-8-17(20(27)28)18(22)9-13/h3-9,11-12H,2,10H2,1H3,(H,24,25)(H,27,28) |
| InChIKey | FKQVTDLFLFQHRZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|