C14H14N2O2S2 — CID 141081754
2-(2-cyanoethylsulfanylmethyl)benzoic acid;1,3-thiazole (PubChem CID 141081754) has the molecular formula C14H14N2O2S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(2-cyanoethylsulfanylmethyl)benzoic acid;1,3-thiazole.
| Compound Name | 2-(2-cyanoethylsulfanylmethyl)benzoic acid;1,3-thiazole |
|---|---|
| PubChem CID | 141081754 |
| Molecular Formula | C14H14N2O2S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-(2-cyanoethylsulfanylmethyl)benzoic acid;1,3-thiazole |
| SMILES | N#CCCSCc1ccccc1C(=O)O.c1cscn1 |
| InChI | InChI=1S/C11H11NO2S.C3H3NS/c12-6-3-7-15-8-9-4-1-2-5-10(9)11(13)14;1-2-5-3-4-1/h1-2,4-5H,3,7-8H2,(H,13,14);1-3H |
| InChIKey | GJVZYWVQMJNAMQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|