C72H78Cl2N2O4Ti — CID 137211426
dichlorotitanium;bis(2-[(4-pent-4-enoxyphenyl)iminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol) (PubChem CID 137211426) has the molecular formula C72H78Cl2N2O4Ti and a molecular weight of 1154.20 g/mol. Its IUPAC name is dichlorotitanium;bis(2-[(4-pent-4-enoxyphenyl)iminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol).
| Compound Name | dichlorotitanium;bis(2-[(4-pent-4-enoxyphenyl)iminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol) |
|---|---|
| PubChem CID | 137211426 |
| Molecular Formula | C72H78Cl2N2O4Ti |
| Molecular Weight | 1154.20 g/mol |
| Exact Mass | 1152.48 |
| IUPAC Name | dichlorotitanium;bis(2-[(4-pent-4-enoxyphenyl)iminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol) |
| SMILES | C=CCCCOc1ccc(/N=C/c2cc(C(C)(C)c3ccccc3)cc(C(C)(C)c3ccccc3)c2O)cc1.C=CCCCOc1ccc(/N=C\c2cc(C(C)(C)c3ccccc3)cc(C(C)(C)c3ccccc3)c2O)cc1.Cl[Ti]Cl |
| InChI | InChI=1S/2C36H39NO2.2ClH.Ti/c2*1-6-7-14-23-39-32-21-19-31(20-22-32)37-26-27-24-30(35(2,3)28-15-10-8-11-16-28)25-33(34(27)38)36(4,5)29-17-12-9-13-18-29;;;/h2*6,8-13,15-22,24-26,38H,1,7,14,23H2,2-5H3;2*1H;/q;;;;+2/p-2/b37-26+;37-26-;;; |
| InChIKey | PBXWLMNQNZWRJZ-YCXFUSIZSA-L |
| XLogP | 19.66 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1154.20 |
| LogP ≤ 5 | 19.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|