C52H54Cl2N2O4Ti — CID 137176075
bis(2-[(2-but-3-enoxyphenyl)iminomethyl]-6-(2-phenylpropan-2-yl)phenol);dichlorotitanium (PubChem CID 137176075) has the molecular formula C52H54Cl2N2O4Ti and a molecular weight of 889.79 g/mol. Its IUPAC name is bis(2-[(2-but-3-enoxyphenyl)iminomethyl]-6-(2-phenylpropan-2-yl)phenol);dichlorotitanium.
| Compound Name | bis(2-[(2-but-3-enoxyphenyl)iminomethyl]-6-(2-phenylpropan-2-yl)phenol);dichlorotitanium |
|---|---|
| PubChem CID | 137176075 |
| Molecular Formula | C52H54Cl2N2O4Ti |
| Molecular Weight | 889.79 g/mol |
| Exact Mass | 888.29 |
| IUPAC Name | bis(2-[(2-but-3-enoxyphenyl)iminomethyl]-6-(2-phenylpropan-2-yl)phenol);dichlorotitanium |
| SMILES | C=CCCOc1ccccc1/N=C/c1cccc(C(C)(C)c2ccccc2)c1O.C=CCCOc1ccccc1/N=C\c1cccc(C(C)(C)c2ccccc2)c1O.Cl[Ti]Cl |
| InChI | InChI=1S/2C26H27NO2.2ClH.Ti/c2*1-4-5-18-29-24-17-10-9-16-23(24)27-19-20-12-11-15-22(25(20)28)26(2,3)21-13-7-6-8-14-21;;;/h2*4,6-17,19,28H,1,5,18H2,2-3H3;2*1H;/q;;;;+2/p-2/b27-19+;27-19-;;; |
| InChIKey | GJAJWRABCWHMTR-JTRVHICJSA-L |
| XLogP | 14.22 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.79 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|