C29H26N2O7 — CID 136908456
3-[[2-[3-[2-[(2,3-dihydroxyphenyl)methylideneamino]phenoxy]-2-hydroxypropoxy]phenyl]iminomethyl]benzene-1,2-diol (PubChem CID 136908456) has the molecular formula C29H26N2O7 and a molecular weight of 514.53 g/mol. Its IUPAC name is 3-[[2-[3-[2-[(2,3-dihydroxyphenyl)methylideneamino]phenoxy]-2-hydroxypropoxy]phenyl]iminomethyl]benzene-1,2-diol.
| Compound Name | 3-[[2-[3-[2-[(2,3-dihydroxyphenyl)methylideneamino]phenoxy]-2-hydroxypropoxy]phenyl]iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136908456 |
| Molecular Formula | C29H26N2O7 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 3-[[2-[3-[2-[(2,3-dihydroxyphenyl)methylideneamino]phenoxy]-2-hydroxypropoxy]phenyl]iminomethyl]benzene-1,2-diol |
| SMILES | Oc1cccc(/C=N/c2ccccc2OCC(O)COc2ccccc2/N=C/c2cccc(O)c2O)c1O |
| InChI | InChI=1S/C29H26N2O7/c32-21(17-37-26-13-3-1-9-22(26)30-15-19-7-5-11-24(33)28(19)35)18-38-27-14-4-2-10-23(27)31-16-20-8-6-12-25(34)29(20)36/h1-16,21,32-36H,17-18H2/b30-15+,31-16+ |
| InChIKey | IJLBESLLVOUQGU-KUGLDEIXSA-N |
| XLogP | 4.83 |
| TPSA | 144.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|