C44H52N2O2+2 — CID 146980431
4,6,23-tritert-butyl-21-[4-(4-methylphenyl)butyl]-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene (PubChem CID 146980431) has the molecular formula C44H52N2O2+2 and a molecular weight of 640.91 g/mol. Its IUPAC name is 4,6,23-tritert-butyl-21-[4-(4-methylphenyl)butyl]-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene.
| Compound Name | 4,6,23-tritert-butyl-21-[4-(4-methylphenyl)butyl]-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene |
|---|---|
| PubChem CID | 146980431 |
| Molecular Formula | C44H52N2O2+2 |
| Molecular Weight | 640.91 g/mol |
| Exact Mass | 640.40 |
| IUPAC Name | 4,6,23-tritert-butyl-21-[4-(4-methylphenyl)butyl]-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene |
| SMILES | Cc1ccc(CCCCc2cc3c(c(C(C)(C)C)c2)OC24Oc5c(cc(C(C)(C)C)cc5C(C)(C)C)C=[N+]2c2ccccc2[N+]4=C3)cc1 |
| InChI | InChI=1S/C44H52N2O2/c1-29-19-21-30(22-20-29)15-11-12-16-31-23-32-27-45-37-17-13-14-18-38(37)46-28-33-25-34(41(2,3)4)26-36(43(8,9)10)40(33)48-44(45,46)47-39(32)35(24-31)42(5,6)7/h13-14,17-28H,11-12,15-16H2,1-10H3/q+2 |
| InChIKey | VGSNOKZFXPPHRN-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 24.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.91 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|