C23H32 — CID 101326636
1,3-ditert-butyl-5-(3-phenylpropyl)benzene (PubChem CID 101326636) has the molecular formula C23H32 and a molecular weight of 308.51 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-(3-phenylpropyl)benzene.
| Compound Name | 1,3-ditert-butyl-5-(3-phenylpropyl)benzene |
|---|---|
| PubChem CID | 101326636 |
| Molecular Formula | C23H32 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 1,3-ditert-butyl-5-(3-phenylpropyl)benzene |
| SMILES | CC(C)(C)c1cc(CCCc2ccccc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H32/c1-22(2,3)20-15-19(16-21(17-20)23(4,5)6)14-10-13-18-11-8-7-9-12-18/h7-9,11-12,15-17H,10,13-14H2,1-6H3 |
| InChIKey | OBQLNDUVTNWBBZ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |