C33H38Si — CID 174063345
dibenzyl-(3-tert-butylphenyl)-(3-phenylpropyl)silane (PubChem CID 174063345) has the molecular formula C33H38Si and a molecular weight of 462.75 g/mol. Its IUPAC name is dibenzyl-(3-tert-butylphenyl)-(3-phenylpropyl)silane.
| Compound Name | dibenzyl-(3-tert-butylphenyl)-(3-phenylpropyl)silane |
|---|---|
| PubChem CID | 174063345 |
| Molecular Formula | C33H38Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | dibenzyl-(3-tert-butylphenyl)-(3-phenylpropyl)silane |
| SMILES | CC(C)(C)c1cccc([Si](CCCc2ccccc2)(Cc2ccccc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C33H38Si/c1-33(2,3)31-22-13-23-32(25-31)34(26-29-17-9-5-10-18-29,27-30-19-11-6-12-20-30)24-14-21-28-15-7-4-8-16-28/h4-13,15-20,22-23,25H,14,21,24,26-27H2,1-3H3 |
| InChIKey | CVBTVLCMWSRVDI-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|