C44H72NPSi2 — CID 171491145
N-bis(3-tributylsilylphenyl)phosphanyl-2-phenylethanamine (PubChem CID 171491145) has the molecular formula C44H72NPSi2 and a molecular weight of 702.21 g/mol. Its IUPAC name is N-bis(3-tributylsilylphenyl)phosphanyl-2-phenylethanamine.
| Compound Name | N-bis(3-tributylsilylphenyl)phosphanyl-2-phenylethanamine |
|---|---|
| PubChem CID | 171491145 |
| Molecular Formula | C44H72NPSi2 |
| Molecular Weight | 702.21 g/mol |
| Exact Mass | 701.49 |
| IUPAC Name | N-bis(3-tributylsilylphenyl)phosphanyl-2-phenylethanamine |
| SMILES | CCCC[Si](CCCC)(CCCC)c1cccc(P(NCCc2ccccc2)c2cccc([Si](CCCC)(CCCC)CCCC)c2)c1 |
| InChI | InChI=1S/C44H72NPSi2/c1-7-13-32-47(33-14-8-2,34-15-9-3)43-28-22-26-41(38-43)46(45-31-30-40-24-20-19-21-25-40)42-27-23-29-44(39-42)48(35-16-10-4,36-17-11-5)37-18-12-6/h19-29,38-39,45H,7-18,30-37H2,1-6H3 |
| InChIKey | ITDYQBHLPYHNRY-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.21 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|