C75H131NP2Si4 — CID 171491214
N-bis(3-tributylsilylphenyl)phosphanyl-N-bis(4-tributylsilylphenyl)phosphanylpropan-2-amine (PubChem CID 171491214) has the molecular formula C75H131NP2Si4 and a molecular weight of 1221.17 g/mol. Its IUPAC name is N-bis(3-tributylsilylphenyl)phosphanyl-N-bis(4-tributylsilylphenyl)phosphanylpropan-2-amine.
| Compound Name | N-bis(3-tributylsilylphenyl)phosphanyl-N-bis(4-tributylsilylphenyl)phosphanylpropan-2-amine |
|---|---|
| PubChem CID | 171491214 |
| Molecular Formula | C75H131NP2Si4 |
| Molecular Weight | 1221.17 g/mol |
| Exact Mass | 1219.88 |
| IUPAC Name | N-bis(3-tributylsilylphenyl)phosphanyl-N-bis(4-tributylsilylphenyl)phosphanylpropan-2-amine |
| SMILES | CCCC[Si](CCCC)(CCCC)c1ccc(P(c2ccc([Si](CCCC)(CCCC)CCCC)cc2)N(C(C)C)P(c2cccc([Si](CCCC)(CCCC)CCCC)c2)c2cccc([Si](CCCC)(CCCC)CCCC)c2)cc1 |
| InChI | InChI=1S/C75H131NP2Si4/c1-15-27-53-79(54-28-16-2,55-29-17-3)72-49-45-68(46-50-72)77(69-47-51-73(52-48-69)80(56-30-18-4,57-31-19-5)58-32-20-6)76(67(13)14)78(70-41-39-43-74(65-70)81(59-33-21-7,60-34-22-8)61-35-23-9)71-42-40-44-75(66-71)82(62-36-24-10,63-37-25-11)64-38-26-12/h39-52,65-67H,15-38,53-64H2,1-14H3 |
| InChIKey | XYEKDDXFTVJQCG-UHFFFAOYSA-N |
| XLogP | 22.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1221.17 |
| LogP ≤ 5 | 22.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|