C66H105NP2Si4 — CID 172633992
N,N-bis[bis(4-tripropylsilylphenyl)phosphanyl]aniline (PubChem CID 172633992) has the molecular formula C66H105NP2Si4 and a molecular weight of 1086.87 g/mol. Its IUPAC name is N,N-bis[bis(4-tripropylsilylphenyl)phosphanyl]aniline.
| Compound Name | N,N-bis[bis(4-tripropylsilylphenyl)phosphanyl]aniline |
|---|---|
| PubChem CID | 172633992 |
| Molecular Formula | C66H105NP2Si4 |
| Molecular Weight | 1086.87 g/mol |
| Exact Mass | 1085.68 |
| IUPAC Name | N,N-bis[bis(4-tripropylsilylphenyl)phosphanyl]aniline |
| SMILES | CCC[Si](CCC)(CCC)c1ccc(P(c2ccc([Si](CCC)(CCC)CCC)cc2)N(c2ccccc2)P(c2ccc([Si](CCC)(CCC)CCC)cc2)c2ccc([Si](CCC)(CCC)CCC)cc2)cc1 |
| InChI | InChI=1S/C66H105NP2Si4/c1-13-46-70(47-14-2,48-15-3)63-38-30-59(31-39-63)68(60-32-40-64(41-33-60)71(49-16-4,50-17-5)51-18-6)67(58-28-26-25-27-29-58)69(61-34-42-65(43-35-61)72(52-19-7,53-20-8)54-21-9)62-36-44-66(45-37-62)73(55-22-10,56-23-11)57-24-12/h25-45H,13-24,46-57H2,1-12H3 |
| InChIKey | IQTRGIQLRVYMKL-UHFFFAOYSA-N |
| XLogP | 18.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1086.87 |
| LogP ≤ 5 | 18.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|