C58H97NP2Si4 — CID 176550922
N-bis(4-tributylsilylphenyl)phosphanyl-N-[(2-trimethylsilylphenyl)-(4-trimethylsilylphenyl)phosphanyl]butan-1-amine (PubChem CID 176550922) has the molecular formula C58H97NP2Si4 and a molecular weight of 982.71 g/mol. Its IUPAC name is N-bis(4-tributylsilylphenyl)phosphanyl-N-[(2-trimethylsilylphenyl)-(4-trimethylsilylphenyl)phosphanyl]butan-1-amine.
| Compound Name | N-bis(4-tributylsilylphenyl)phosphanyl-N-[(2-trimethylsilylphenyl)-(4-trimethylsilylphenyl)phosphanyl]butan-1-amine |
|---|---|
| PubChem CID | 176550922 |
| Molecular Formula | C58H97NP2Si4 |
| Molecular Weight | 982.71 g/mol |
| Exact Mass | 981.62 |
| IUPAC Name | N-bis(4-tributylsilylphenyl)phosphanyl-N-[(2-trimethylsilylphenyl)-(4-trimethylsilylphenyl)phosphanyl]butan-1-amine |
| SMILES | CCCCN(P(c1ccc([Si](CCCC)(CCCC)CCCC)cc1)c1ccc([Si](CCCC)(CCCC)CCCC)cc1)P(c1ccc([Si](C)(C)C)cc1)c1ccccc1[Si](C)(C)C |
| InChI | InChI=1S/C58H97NP2Si4/c1-14-21-44-59(61(53-32-38-54(39-33-53)62(8,9)10)57-30-28-29-31-58(57)63(11,12)13)60(51-34-40-55(41-35-51)64(45-22-15-2,46-23-16-3)47-24-17-4)52-36-42-56(43-37-52)65(48-25-18-5,49-26-19-6)50-27-20-7/h28-43H,14-27,44-50H2,1-13H3 |
| InChIKey | WODWDERDAYNWQF-UHFFFAOYSA-N |
| XLogP | 15.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.71 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|