C71H121NP2Si4 — CID 171491143
N-bis(4-tributylsilylphenyl)phosphanyl-N-bis(3-tripropylsilylphenyl)phosphanylcyclopentanamine (PubChem CID 171491143) has the molecular formula C71H121NP2Si4 and a molecular weight of 1163.05 g/mol. Its IUPAC name is N-bis(4-tributylsilylphenyl)phosphanyl-N-bis(3-tripropylsilylphenyl)phosphanylcyclopentanamine.
| Compound Name | N-bis(4-tributylsilylphenyl)phosphanyl-N-bis(3-tripropylsilylphenyl)phosphanylcyclopentanamine |
|---|---|
| PubChem CID | 171491143 |
| Molecular Formula | C71H121NP2Si4 |
| Molecular Weight | 1163.05 g/mol |
| Exact Mass | 1161.81 |
| IUPAC Name | N-bis(4-tributylsilylphenyl)phosphanyl-N-bis(3-tripropylsilylphenyl)phosphanylcyclopentanamine |
| SMILES | CCCC[Si](CCCC)(CCCC)c1ccc(P(c2ccc([Si](CCCC)(CCCC)CCCC)cc2)N(C2CCCC2)P(c2cccc([Si](CCC)(CCC)CCC)c2)c2cccc([Si](CCC)(CCC)CCC)c2)cc1 |
| InChI | InChI=1S/C71H121NP2Si4/c1-13-25-55-77(56-26-14-2,57-27-15-3)68-45-41-64(42-46-68)73(65-43-47-69(48-44-65)78(58-28-16-4,59-29-17-5)60-30-18-6)72(63-35-31-32-36-63)74(66-37-33-39-70(61-66)75(49-19-7,50-20-8)51-21-9)67-38-34-40-71(62-67)76(52-22-10,53-23-11)54-24-12/h33-34,37-48,61-63H,13-32,35-36,49-60H2,1-12H3 |
| InChIKey | YXXBDXBQVRJFBD-UHFFFAOYSA-N |
| XLogP | 20.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1163.05 |
| LogP ≤ 5 | 20.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|