C63H85NP2Si — CID 172634044
N,N-bis[bis(4-cyclohexylphenyl)phosphanyl]-4-tripropylsilylaniline (PubChem CID 172634044) has the molecular formula C63H85NP2Si and a molecular weight of 946.41 g/mol. Its IUPAC name is N,N-bis[bis(4-cyclohexylphenyl)phosphanyl]-4-tripropylsilylaniline.
| Compound Name | N,N-bis[bis(4-cyclohexylphenyl)phosphanyl]-4-tripropylsilylaniline |
|---|---|
| PubChem CID | 172634044 |
| Molecular Formula | C63H85NP2Si |
| Molecular Weight | 946.41 g/mol |
| Exact Mass | 945.59 |
| IUPAC Name | N,N-bis[bis(4-cyclohexylphenyl)phosphanyl]-4-tripropylsilylaniline |
| SMILES | CCC[Si](CCC)(CCC)c1ccc(N(P(c2ccc(C3CCCCC3)cc2)c2ccc(C3CCCCC3)cc2)P(c2ccc(C3CCCCC3)cc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C63H85NP2Si/c1-4-47-67(48-5-2,49-6-3)63-45-35-58(36-46-63)64(65(59-37-27-54(28-38-59)50-19-11-7-12-20-50)60-39-29-55(30-40-60)51-21-13-8-14-22-51)66(61-41-31-56(32-42-61)52-23-15-9-16-24-52)62-43-33-57(34-44-62)53-25-17-10-18-26-53/h27-46,50-53H,4-26,47-49H2,1-3H3 |
| InChIKey | YTSYJZAEMJKJMB-UHFFFAOYSA-N |
| XLogP | 17.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.41 |
| LogP ≤ 5 | 17.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|