C66H109FNP2Si3+ — CID 176550936
[bis(4-tributylsilylphenyl)phosphanylamino]-cyclohexyl-(2-fluorophenyl)-(4-tributylsilylphenyl)phosphanium (PubChem CID 176550936) has the molecular formula C66H109FNP2Si3+ and a molecular weight of 1081.81 g/mol. Its IUPAC name is [bis(4-tributylsilylphenyl)phosphanylamino]-cyclohexyl-(2-fluorophenyl)-(4-tributylsilylphenyl)phosphanium.
| Compound Name | [bis(4-tributylsilylphenyl)phosphanylamino]-cyclohexyl-(2-fluorophenyl)-(4-tributylsilylphenyl)phosphanium |
|---|---|
| PubChem CID | 176550936 |
| Molecular Formula | C66H109FNP2Si3+ |
| Molecular Weight | 1081.81 g/mol |
| Exact Mass | 1080.73 |
| IUPAC Name | [bis(4-tributylsilylphenyl)phosphanylamino]-cyclohexyl-(2-fluorophenyl)-(4-tributylsilylphenyl)phosphanium |
| SMILES | CCCC[Si](CCCC)(CCCC)c1ccc(P(N[P+](c2ccc([Si](CCCC)(CCCC)CCCC)cc2)(c2ccccc2F)C2CCCCC2)c2ccc([Si](CCCC)(CCCC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C66H109FNP2Si3/c1-10-19-49-71(50-20-11-2,51-21-12-3)62-43-37-58(38-44-62)69(59-39-45-63(46-40-59)72(52-22-13-4,53-23-14-5)54-24-15-6)68-70(60-33-29-28-30-34-60,66-36-32-31-35-65(66)67)61-41-47-64(48-42-61)73(55-25-16-7,56-26-17-8)57-27-18-9/h31-32,35-48,60,68H,10-30,33-34,49-57H2,1-9H3/q+1 |
| InChIKey | NMWUEGYMHPADEP-UHFFFAOYSA-N |
| XLogP | 18.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1081.81 |
| LogP ≤ 5 | 18.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|