C15H24FN — CID 70646222
5-(3-tert-butylphenyl)-2-fluoropentan-2-amine (PubChem CID 70646222) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is 5-(3-tert-butylphenyl)-2-fluoropentan-2-amine.
| Compound Name | 5-(3-tert-butylphenyl)-2-fluoropentan-2-amine |
|---|---|
| PubChem CID | 70646222 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | 5-(3-tert-butylphenyl)-2-fluoropentan-2-amine |
| SMILES | CC(N)(F)CCCc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24FN/c1-14(2,3)13-9-5-7-12(11-13)8-6-10-15(4,16)17/h5,7,9,11H,6,8,10,17H2,1-4H3 |
| InChIKey | AEWVLULUTKPNNY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|