C19H18F5N — CID 175006473
3-(3-tert-butylphenyl)-N-(2,3,4,5,6-pentafluorophenyl)propan-1-imine (PubChem CID 175006473) has the molecular formula C19H18F5N and a molecular weight of 355.35 g/mol. Its IUPAC name is 3-(3-tert-butylphenyl)-N-(2,3,4,5,6-pentafluorophenyl)propan-1-imine.
| Compound Name | 3-(3-tert-butylphenyl)-N-(2,3,4,5,6-pentafluorophenyl)propan-1-imine |
|---|---|
| PubChem CID | 175006473 |
| Molecular Formula | C19H18F5N |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 3-(3-tert-butylphenyl)-N-(2,3,4,5,6-pentafluorophenyl)propan-1-imine |
| SMILES | CC(C)(C)c1cccc(CC/C=N/c2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C19H18F5N/c1-19(2,3)12-8-4-6-11(10-12)7-5-9-25-18-16(23)14(21)13(20)15(22)17(18)24/h4,6,8-10H,5,7H2,1-3H3/b25-9+ |
| InChIKey | GDSIBIZWUHUNFV-YCPBAFNGSA-N |
| XLogP | 6.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|