C14H21F2N — CID 66581986
4-(3-tert-butylphenyl)-2,2-difluorobutan-1-amine (PubChem CID 66581986) has the molecular formula C14H21F2N and a molecular weight of 241.32 g/mol. Its IUPAC name is 4-(3-tert-butylphenyl)-2,2-difluorobutan-1-amine.
| Compound Name | 4-(3-tert-butylphenyl)-2,2-difluorobutan-1-amine |
|---|---|
| PubChem CID | 66581986 |
| Molecular Formula | C14H21F2N |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-(3-tert-butylphenyl)-2,2-difluorobutan-1-amine |
| SMILES | CC(C)(C)c1cccc(CCC(F)(F)CN)c1 |
| InChI | InChI=1S/C14H21F2N/c1-13(2,3)12-6-4-5-11(9-12)7-8-14(15,16)10-17/h4-6,9H,7-8,10,17H2,1-3H3 |
| InChIKey | ONHSZVVBKVGFTH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |