C11H13F4N — CID 115040642
2-[3-(1,1,1,2-tetrafluoropropan-2-yl)phenyl]ethanamine (PubChem CID 115040642) has the molecular formula C11H13F4N and a molecular weight of 235.22 g/mol. Its IUPAC name is 2-[3-(1,1,1,2-tetrafluoropropan-2-yl)phenyl]ethanamine.
| Compound Name | 2-[3-(1,1,1,2-tetrafluoropropan-2-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 115040642 |
| Molecular Formula | C11H13F4N |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-[3-(1,1,1,2-tetrafluoropropan-2-yl)phenyl]ethanamine |
| SMILES | CC(F)(c1cccc(CCN)c1)C(F)(F)F |
| InChI | InChI=1S/C11H13F4N/c1-10(12,11(13,14)15)9-4-2-3-8(7-9)5-6-16/h2-4,7H,5-6,16H2,1H3 |
| InChIKey | HPWSECLPMOFXCA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |