C13H20FN — CID 115026580
[3-(2-fluoro-3,3-dimethylbutan-2-yl)phenyl]methanamine (PubChem CID 115026580) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is [3-(2-fluoro-3,3-dimethylbutan-2-yl)phenyl]methanamine.
| Compound Name | [3-(2-fluoro-3,3-dimethylbutan-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 115026580 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | [3-(2-fluoro-3,3-dimethylbutan-2-yl)phenyl]methanamine |
| SMILES | CC(C)(C)C(C)(F)c1cccc(CN)c1 |
| InChI | InChI=1S/C13H20FN/c1-12(2,3)13(4,14)11-7-5-6-10(8-11)9-15/h5-8H,9,15H2,1-4H3 |
| InChIKey | ZPTJDUYOSLUTKG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |