C13H19FN2 — CID 115033504
[3-(1-fluoro-1-pyrrolidin-3-ylethyl)phenyl]methanamine (PubChem CID 115033504) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is [3-(1-fluoro-1-pyrrolidin-3-ylethyl)phenyl]methanamine.
| Compound Name | [3-(1-fluoro-1-pyrrolidin-3-ylethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 115033504 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | [3-(1-fluoro-1-pyrrolidin-3-ylethyl)phenyl]methanamine |
| SMILES | CC(F)(c1cccc(CN)c1)C1CCNC1 |
| InChI | InChI=1S/C13H19FN2/c1-13(14,12-5-6-16-9-12)11-4-2-3-10(7-11)8-15/h2-4,7,12,16H,5-6,8-9,15H2,1H3 |
| InChIKey | HAIDCNBHSQKTEF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |