C14H18F3NO — CID 125492642
(1R)-1-[(3R)-pyrrolidin-3-yl]-1-[3-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 125492642) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is (1R)-1-[(3R)-pyrrolidin-3-yl]-1-[3-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | (1R)-1-[(3R)-pyrrolidin-3-yl]-1-[3-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 125492642 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (1R)-1-[(3R)-pyrrolidin-3-yl]-1-[3-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | CC[C@](O)(c1cccc(C(F)(F)F)c1)[C@@H]1CCNC1 |
| InChI | InChI=1S/C14H18F3NO/c1-2-13(19,12-6-7-18-9-12)10-4-3-5-11(8-10)14(15,16)17/h3-5,8,12,18-19H,2,6-7,9H2,1H3/t12-,13+/m1/s1 |
| InChIKey | VZXKBJUDLKBCBJ-OLZOCXBDSA-N |
| XLogP | 2.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |