C22H20F3N — CID 58915478
N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-imine (PubChem CID 58915478) has the molecular formula C22H20F3N and a molecular weight of 355.40 g/mol. Its IUPAC name is N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-imine.
| Compound Name | N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-imine |
|---|---|
| PubChem CID | 58915478 |
| Molecular Formula | C22H20F3N |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-imine |
| SMILES | C[C@@H](/N=C/CCc1cccc(C(F)(F)F)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H20F3N/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25/h2-5,7,9-16H,6,8H2,1H3/b26-14+/t16-/m1/s1 |
| InChIKey | TWIYOSNSQRGTGO-JOBSNELWSA-N |
| XLogP | 6.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|