C30H29F3N+ — CID 91384132
benzylidene-(1-naphthalen-1-ylpropyl)-[3-[3-(trifluoromethyl)phenyl]propyl]azanium (PubChem CID 91384132) has the molecular formula C30H29F3N+ and a molecular weight of 460.56 g/mol. Its IUPAC name is benzylidene-(1-naphthalen-1-ylpropyl)-[3-[3-(trifluoromethyl)phenyl]propyl]azanium.
| Compound Name | benzylidene-(1-naphthalen-1-ylpropyl)-[3-[3-(trifluoromethyl)phenyl]propyl]azanium |
|---|---|
| PubChem CID | 91384132 |
| Molecular Formula | C30H29F3N+ |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | benzylidene-(1-naphthalen-1-ylpropyl)-[3-[3-(trifluoromethyl)phenyl]propyl]azanium |
| SMILES | CCC(c1cccc2ccccc12)/[N+](=C/c1ccccc1)CCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H29F3N/c1-2-29(28-19-9-16-25-15-6-7-18-27(25)28)34(22-24-11-4-3-5-12-24)20-10-14-23-13-8-17-26(21-23)30(31,32)33/h3-9,11-13,15-19,21-22,29H,2,10,14,20H2,1H3/q+1/b34-22+ |
| InChIKey | HKIGJEKHZODBFP-PPOKSSTKSA-N |
| XLogP | 8.07 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|