C22H21F3NO- — CID 46234196
N-[(1R)-1-naphthalen-1-ylethyl]-N-oxido-3-[3-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 46234196) has the molecular formula C22H21F3NO- and a molecular weight of 372.41 g/mol. Its IUPAC name is N-[(1R)-1-naphthalen-1-ylethyl]-N-oxido-3-[3-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | N-[(1R)-1-naphthalen-1-ylethyl]-N-oxido-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 46234196 |
| Molecular Formula | C22H21F3NO- |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-[(1R)-1-naphthalen-1-ylethyl]-N-oxido-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | C[C@H](c1cccc2ccccc12)N([O-])CCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F3NO/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26(27)14-6-8-17-7-4-11-19(15-17)22(23,24)25/h2-5,7,9-13,15-16H,6,8,14H2,1H3/q-1/t16-/m1/s1 |
| InChIKey | KZTXAWPZLGJYQH-MRXNPFEDSA-N |
| XLogP | 6.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|