C22H19F3INO — CID 24854936
2-iodo-N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 24854936) has the molecular formula C22H19F3INO and a molecular weight of 497.30 g/mol. Its IUPAC name is 2-iodo-N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-iodo-N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 24854936 |
| Molecular Formula | C22H19F3INO |
| Molecular Weight | 497.30 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | 2-iodo-N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@@H](NC(=O)C(I)Cc1cccc(C(F)(F)F)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H19F3INO/c1-14(18-11-5-8-16-7-2-3-10-19(16)18)27-21(28)20(26)13-15-6-4-9-17(12-15)22(23,24)25/h2-12,14,20H,13H2,1H3,(H,27,28)/t14-,20?/m1/s1 |
| InChIKey | BFZDQLVSDOLGBW-QMRFKDRMSA-N |
| XLogP | 6.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.30 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|