C44H42F6N2O — CID 158763688
(1R)-1-naphthalen-1-ylethanamine;N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-imine;3-[3-(trifluoromethyl)phenyl]propanal (PubChem CID 158763688) has the molecular formula C44H42F6N2O and a molecular weight of 728.82 g/mol. Its IUPAC name is (1R)-1-naphthalen-1-ylethanamine;N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-imine;3-[3-(trifluoromethyl)phenyl]propanal.
| Compound Name | (1R)-1-naphthalen-1-ylethanamine;N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-imine;3-[3-(trifluoromethyl)phenyl]propanal |
|---|---|
| PubChem CID | 158763688 |
| Molecular Formula | C44H42F6N2O |
| Molecular Weight | 728.82 g/mol |
| Exact Mass | 728.32 |
| IUPAC Name | (1R)-1-naphthalen-1-ylethanamine;N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-imine;3-[3-(trifluoromethyl)phenyl]propanal |
| SMILES | C[C@@H](/N=C/CCc1cccc(C(F)(F)F)c1)c1cccc2ccccc12.C[C@@H](N)c1cccc2ccccc12.O=CCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F3N.C12H13N.C10H9F3O/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25;1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;11-10(12,13)9-5-1-3-8(7-9)4-2-6-14/h2-5,7,9-16H,6,8H2,1H3;2-9H,13H2,1H3;1,3,5-7H,2,4H2/b26-14+;;/t16-;9-;/m11./s1 |
| InChIKey | IOZKSWHXOFHICV-FRWFZLCSSA-N |
| XLogP | 12.32 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.82 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|