C22H22F3N — CID 89059274
1,1,3,3-tetradeuterio-N-(1,2,2,2-tetradeuterio-1-naphthalen-1-ylethyl)-3-[3-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 89059274) has the molecular formula C22H22F3N and a molecular weight of 365.47 g/mol. Its IUPAC name is 1,1,3,3-tetradeuterio-N-(1,2,2,2-tetradeuterio-1-naphthalen-1-ylethyl)-3-[3-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | 1,1,3,3-tetradeuterio-N-(1,2,2,2-tetradeuterio-1-naphthalen-1-ylethyl)-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 89059274 |
| Molecular Formula | C22H22F3N |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 1,1,3,3-tetradeuterio-N-(1,2,2,2-tetradeuterio-1-naphthalen-1-ylethyl)-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | [2H]C([2H])(CC([2H])([2H])c1cccc(C(F)(F)F)c1)NC([2H])(c1cccc2ccccc12)C([2H])([2H])[2H] |
| InChI | InChI=1S/C22H22F3N/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25/h2-5,7,9-13,15-16,26H,6,8,14H2,1H3/i1D3,8D2,14D2,16D |
| InChIKey | VDHAWDNDOKGFTD-ZARNLOHWSA-N |
| XLogP | 6.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |