C22H22F3N — CID 46240939
1,1,3,3-tetradeuterio-N-[(1R)-2,2,2-trideuterio-1-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 46240939) has the molecular formula C22H22F3N and a molecular weight of 371.50 g/mol. Its IUPAC name is 1,1,3,3-tetradeuterio-N-[(1R)-2,2,2-trideuterio-1-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | 1,1,3,3-tetradeuterio-N-[(1R)-2,2,2-trideuterio-1-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 46240939 |
| Molecular Formula | C22H22F3N |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 1,1,3,3-tetradeuterio-N-[(1R)-2,2,2-trideuterio-1-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c([C@H](NC([2H])([2H])CC([2H])([2H])c3cccc(C(F)(F)F)c3)C([2H])([2H])[2H])c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C22H22F3N/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25/h2-5,7,9-13,15-16,26H,6,8,14H2,1H3/t16-/m1/s1/i1D3,2D,3D,5D,8D2,9D,10D,12D,13D,14D2 |
| InChIKey | VDHAWDNDOKGFTD-KYPLRAAASA-N |
| XLogP | 6.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |