C22H23ClF3N — CID 161266709
1,1,3,3-tetradeuterio-N-[(1R)-1,2,2,2-tetradeuterio-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (PubChem CID 161266709) has the molecular formula C22H23ClF3N and a molecular weight of 401.93 g/mol. Its IUPAC name is 1,1,3,3-tetradeuterio-N-[(1R)-1,2,2,2-tetradeuterio-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride.
| Compound Name | 1,1,3,3-tetradeuterio-N-[(1R)-1,2,2,2-tetradeuterio-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 161266709 |
| Molecular Formula | C22H23ClF3N |
| Molecular Weight | 401.93 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1,1,3,3-tetradeuterio-N-[(1R)-1,2,2,2-tetradeuterio-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| SMILES | Cl.[2H]C([2H])(CC([2H])([2H])c1cccc(C(F)(F)F)c1)N[C@@]([2H])(c1cccc2ccccc12)C([2H])([2H])[2H] |
| InChI | InChI=1S/C22H22F3N.ClH/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25;/h2-5,7,9-13,15-16,26H,6,8,14H2,1H3;1H/t16-;/m1./s1/i1D3,8D2,14D2,16D; |
| InChIKey | QANQWUQOEJZMLL-SZZHFBHDSA-N |
| XLogP | 6.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.93 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |