C37H38N6O2+2 — CID 161101320
6,21-bis(4-imidazol-1-ylbutyl)-4,23-dimethyl-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene (PubChem CID 161101320) has the molecular formula C37H38N6O2+2 and a molecular weight of 598.75 g/mol. Its IUPAC name is 6,21-bis(4-imidazol-1-ylbutyl)-4,23-dimethyl-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene.
| Compound Name | 6,21-bis(4-imidazol-1-ylbutyl)-4,23-dimethyl-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene |
|---|---|
| PubChem CID | 161101320 |
| Molecular Formula | C37H38N6O2+2 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | 6,21-bis(4-imidazol-1-ylbutyl)-4,23-dimethyl-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene |
| SMILES | Cc1cc(CCCCn2ccnc2)cc2c1OC13Oc4c(C)cc(CCCCn5ccnc5)cc4C=[N+]1c1ccccc1[N+]3=C2 |
| InChI | InChI=1S/C37H38N6O2/c1-27-19-29(9-5-7-15-40-17-13-38-25-40)21-31-23-42-33-11-3-4-12-34(33)43-24-32-22-30(10-6-8-16-41-18-14-39-26-41)20-28(2)36(32)45-37(42,43)44-35(27)31/h3-4,11-14,17-26H,5-10,15-16H2,1-2H3/q+2 |
| InChIKey | SSGWLKSDOJOMAY-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 60.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|