C40H52N2O2+2 — CID 157090336
4,6-ditert-butyl-23-methyl-21-(5-methylnonan-5-yl)-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene (PubChem CID 157090336) has the molecular formula C40H52N2O2+2 and a molecular weight of 592.87 g/mol. Its IUPAC name is 4,6-ditert-butyl-23-methyl-21-(5-methylnonan-5-yl)-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene.
| Compound Name | 4,6-ditert-butyl-23-methyl-21-(5-methylnonan-5-yl)-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene |
|---|---|
| PubChem CID | 157090336 |
| Molecular Formula | C40H52N2O2+2 |
| Molecular Weight | 592.87 g/mol |
| Exact Mass | 592.40 |
| IUPAC Name | 4,6-ditert-butyl-23-methyl-21-(5-methylnonan-5-yl)-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene |
| SMILES | CCCCC(C)(CCCC)c1cc(C)c2c(c1)C=[N+]1c3ccccc3[N+]3=Cc4cc(C(C)(C)C)cc(C(C)(C)C)c4OC13O2 |
| InChI | InChI=1S/C40H52N2O2/c1-11-13-19-39(10,20-14-12-2)31-21-27(3)35-28(23-31)25-41-33-17-15-16-18-34(33)42-26-29-22-30(37(4,5)6)24-32(38(7,8)9)36(29)44-40(41,42)43-35/h15-18,21-26H,11-14,19-20H2,1-10H3/q+2 |
| InChIKey | ZSFGQJWFYVIGGZ-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 24.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.87 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|