C43H50AlFN2O4 — CID 155648253
(14,16,22,24-tetratert-butyl-18,20-dioxa-3,10-diaza-19-aluminatetracyclo[19.4.0.04,9.012,17]pentacosa-1(21),2,4,6,8,10,12(17),13,15,22,24-undecaen-19-yl) 4-fluorobenzoate (PubChem CID 155648253) has the molecular formula C43H50AlFN2O4 and a molecular weight of 704.86 g/mol. Its IUPAC name is (14,16,22,24-tetratert-butyl-18,20-dioxa-3,10-diaza-19-aluminatetracyclo[19.4.0.04,9.012,17]pentacosa-1(21),2,4,6,8,10,12(17),13,15,22,24-undecaen-19-yl) 4-fluorobenzoate.
| Compound Name | (14,16,22,24-tetratert-butyl-18,20-dioxa-3,10-diaza-19-aluminatetracyclo[19.4.0.04,9.012,17]pentacosa-1(21),2,4,6,8,10,12(17),13,15,22,24-undecaen-19-yl) 4-fluorobenzoate |
|---|---|
| PubChem CID | 155648253 |
| Molecular Formula | C43H50AlFN2O4 |
| Molecular Weight | 704.86 g/mol |
| Exact Mass | 704.36 |
| IUPAC Name | (14,16,22,24-tetratert-butyl-18,20-dioxa-3,10-diaza-19-aluminatetracyclo[19.4.0.04,9.012,17]pentacosa-1(21),2,4,6,8,10,12(17),13,15,22,24-undecaen-19-yl) 4-fluorobenzoate |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)O[Al](OC(=O)c1ccc(F)cc1)Oc1c(cc(C(C)(C)C)cc1C(C)(C)C)/C=N/c1ccccc1/N=C/2 |
| InChI | InChI=1S/C36H48N2O2.C7H5FO2.Al/c1-33(2,3)25-17-23(31(39)27(19-25)35(7,8)9)21-37-29-15-13-14-16-30(29)38-22-24-18-26(34(4,5)6)20-28(32(24)40)36(10,11)12;8-6-3-1-5(2-4-6)7(9)10;/h13-22,39-40H,1-12H3;1-4H,(H,9,10);/q;;+3/p-3/b37-21+,38-22+;; |
| InChIKey | NMEZZTVTRUNQSC-XIDIDSRISA-K |
| XLogP | 11.13 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.86 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |