C20H18F2O3 — CID 100981481
[(E)-1-(4-fluorophenyl)-4,4-dimethyl-3-oxopent-1-enyl] 4-fluorobenzoate (PubChem CID 100981481) has the molecular formula C20H18F2O3 and a molecular weight of 344.36 g/mol. Its IUPAC name is [(E)-1-(4-fluorophenyl)-4,4-dimethyl-3-oxopent-1-enyl] 4-fluorobenzoate.
| Compound Name | [(E)-1-(4-fluorophenyl)-4,4-dimethyl-3-oxopent-1-enyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 100981481 |
| Molecular Formula | C20H18F2O3 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [(E)-1-(4-fluorophenyl)-4,4-dimethyl-3-oxopent-1-enyl] 4-fluorobenzoate |
| SMILES | CC(C)(C)C(=O)/C=C(/OC(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H18F2O3/c1-20(2,3)18(23)12-17(13-4-8-15(21)9-5-13)25-19(24)14-6-10-16(22)11-7-14/h4-12H,1-3H3/b17-12+ |
| InChIKey | SDZZGERBAOUJAE-SFQUDFHCSA-N |
| XLogP | 4.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|