C18H14F4O2 — CID 147472231
[(E)-3,3,3-trifluoro-1-(4-fluorophenyl)prop-1-enyl] 3,4-dimethylbenzoate (PubChem CID 147472231) has the molecular formula C18H14F4O2 and a molecular weight of 338.30 g/mol. Its IUPAC name is [(E)-3,3,3-trifluoro-1-(4-fluorophenyl)prop-1-enyl] 3,4-dimethylbenzoate.
| Compound Name | [(E)-3,3,3-trifluoro-1-(4-fluorophenyl)prop-1-enyl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 147472231 |
| Molecular Formula | C18H14F4O2 |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | [(E)-3,3,3-trifluoro-1-(4-fluorophenyl)prop-1-enyl] 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)O/C(=C/C(F)(F)F)c2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C18H14F4O2/c1-11-3-4-14(9-12(11)2)17(23)24-16(10-18(20,21)22)13-5-7-15(19)8-6-13/h3-10H,1-2H3/b16-10+ |
| InChIKey | FBZVKWIRKNQPDY-MHWRWJLKSA-N |
| XLogP | 5.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|