C12H13F3O5S — CID 159813657
2-(3,4-dimethylbenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid (PubChem CID 159813657) has the molecular formula C12H13F3O5S and a molecular weight of 326.29 g/mol. Its IUPAC name is 2-(3,4-dimethylbenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid.
| Compound Name | 2-(3,4-dimethylbenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 159813657 |
| Molecular Formula | C12H13F3O5S |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-(3,4-dimethylbenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid |
| SMILES | Cc1ccc(C(=O)OC(CS(=O)(=O)O)C(F)(F)F)cc1C |
| InChI | InChI=1S/C12H13F3O5S/c1-7-3-4-9(5-8(7)2)11(16)20-10(12(13,14)15)6-21(17,18)19/h3-5,10H,6H2,1-2H3,(H,17,18,19) |
| InChIKey | WVAICKZRIFSABN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|